Difference between revisions of "PWY-401"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE-tRNAs PHE-tRNAs] == * common name: ** a tRNAphe * Synonym(s): ** TRNA(PHE) == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE-tRNAs PHE-tRNAs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a tRNAphe |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** TRNA(PHE) |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a tRNAphe}} | |
− | + | {{#set: common name=TRNA(PHE)}} | |
− | + | {{#set: consumed by=PHENYLALANINE--TRNA-LIGASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 10:47, 18 January 2018
Contents
Metabolite PHE-tRNAs
- common name:
- a tRNAphe
- Synonym(s):
- TRNA(PHE)