Difference between revisions of "CMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CMP CMP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP([O-])([O-])=O * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545] == * common name: ** cardiolipin biosynthesis III * Synonym(s): == Reaction(s)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cardiolipin biosynthesis III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''2''' reaction(s) found |
− | * [[ | + | ** [[PHOSPHAGLYPSYN-RXN]] |
− | == Reaction(s) | + | ** [[PGPPHOSPHA-RXN]] |
− | * | + | == Reaction(s) not found == |
− | * | + | * '''1''' reaction(s) not found |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7012 RXN0-7012] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1545 PWY0-1545] | |
− | + | {{#set: common name=cardiolipin biosynthesis III}} | |
− | ** [http:// | + | {{#set: reaction found=2}} |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 10:48, 18 January 2018
Pathway PWY0-1545
- common name:
- cardiolipin biosynthesis III
- Synonym(s):
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ECOCYC: