Difference between revisions of "PWY-5162"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5067 PWY-5067] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C |
− | ** | + | * inchi key: |
+ | ** InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** δ-carotene |
+ | * molecular weight: | ||
+ | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ε,ψ-carotene | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN1F-148]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN1F-147]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281230 5281230] |
− | {{#set: common name= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4444642.html 4444642] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27705 27705] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C08586 C08586] | ||
+ | * HMDB : HMDB36925 | ||
+ | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N}} | ||
+ | {{#set: common name=δ-carotene}} | ||
+ | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: common name=ε,ψ-carotene}} | ||
+ | {{#set: consumed by=RXN1F-148}} | ||
+ | {{#set: produced by=RXN1F-147}} |
Revision as of 10:48, 18 January 2018
Contents
Metabolite CPD1F-115
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
- inchi key:
- InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N
- common name:
- δ-carotene
- molecular weight:
- 536.882
- Synonym(s):
- ε,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links