Difference between revisions of "HOMOGENTISATE-12-DIOXYGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-2,3-stearoyl-CoA-reduct...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546] ==
−
* smiles:
+
* direction:
−
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
+
 
* common name:
 
* common name:
−
** L-canavanine
+
** trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)
−
* molecular weight:
+
* ec number:
−
** 177.183   
+
** [http://enzyme.expasy.org/EC/1.3.1 EC-1.3.1]
 
* Synonym(s):
 
* Synonym(s):
−
** canavanine
 
−
** 2-amino-4-(guanidinooxy)butyrate
 
−
** 2-amino-4-(guanidinooxy)butyric acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-22]]
+
** 1 [[CPD-10262]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[STEAROYL-COA]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 trans-octadec-2-enoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 stearoyl-CoA[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00008438001_1]]
 +
** [[pantograph]]-[[a.taliana]]
 +
== Pathways  ==
 +
* [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[a.taliana]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* CAS : 543-38-4
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07761 R07761]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEBI:
+
{{#set: common name=trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
+
{{#set: ec number=EC-1.3.1}}
−
* LIGAND-CPD:
+
{{#set: gene associated=CHC_T00008438001_1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
+
{{#set: in pathway=PWY-5972}}
−
* HMDB : HMDB02706
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
+
{{#set: reconstruction source=a.taliana}}
−
{{#set: common name=L-canavanine}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=177.183    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
+
{{#set: reconstruction source=original_genome}}
−
{{#set: produced by=RXN-22}}
+

Revision as of 10:48, 18 January 2018

Reaction RXN-9546

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 trans-octadec-2-enoyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 stearoyl-CoA[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5972, stearate biosynthesis I (animals and fungi): PWY-5972
    • 2 reactions found over 6 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=HOMOGENTISATE-12-DIOXYGENASE-RXN&oldid=4716"