Difference between revisions of "HOMOGENTISATE-12-DIOXYGENASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-2,3-stearoyl-CoA-reduct...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9546 RXN-9546] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific) |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1 EC-1.3.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-10262]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[STEAROYL-COA]][c] '''+''' 1 [[NADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 trans-octadec-2-enoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 stearoyl-CoA[c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00008438001_1]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5972]], stearate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5972 PWY-5972] | ||
+ | ** '''2''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[a.taliana]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[original_genome]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07761 R07761] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)}} | |
− | + | {{#set: ec number=EC-1.3.1}} | |
− | * LIGAND- | + | {{#set: gene associated=CHC_T00008438001_1}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5972}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=a.taliana}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=original_genome}} |
− | {{#set: | + |
Revision as of 11:48, 18 January 2018
Contents
Reaction RXN-9546
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-2,3-stearoyl-CoA-reductase (NADPH, B-specific)
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-10262[c] + 1 NADPH[c] + 1 PROTON[c] => 1 STEAROYL-COA[c] + 1 NADP[c]
- With common name(s):
- 1 trans-octadec-2-enoyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 stearoyl-CoA[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5972, stearate biosynthesis I (animals and fungi): PWY-5972
- 2 reactions found over 6 reactions in the full pathway
Reconstruction information
External links
- LIGAND-RXN: