Difference between revisions of "RXN-14192"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.232-RXN 2.4.1.232-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.or...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.232-RXN 2.4.1.232-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.232 EC-2.4.1.232] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[Lipid-linked-mannosyl-oligos]][c] '''+''' 1 [[GDP-MANNOSE]][c] '''<=>''' 1 [[Lipid-linked-16-mannosyl-mannose-oligos]][c] '''+''' 1 [[GDP]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 a lipid-linked D-mannose-oligosaccharide[c] '''+''' 1 GDP-α-D-mannose[c] '''<=>''' 1 a lipid-linked α(1->6)-D-mannosyl-D-mannose-oligosaccharide[c] '''+''' 1 GDP[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00009519001_1]] | ||
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | * [[CHC_T00009193001_1]] | ||
| + | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-2.4.1.232}} | |
| − | + | {{#set: gene associated=CHC_T00009519001_1|CHC_T00009193001_1}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=galdieria.sulphuraria}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 10:48, 18 January 2018
Contents
Reaction 2.4.1.232-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Lipid-linked-mannosyl-oligos[c] + 1 GDP-MANNOSE[c] <=> 1 Lipid-linked-16-mannosyl-mannose-oligos[c] + 1 GDP[c]
- With common name(s):
- 1 a lipid-linked D-mannose-oligosaccharide[c] + 1 GDP-α-D-mannose[c] <=> 1 a lipid-linked α(1->6)-D-mannosyl-D-mannose-oligosaccharide[c] + 1 GDP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
