Difference between revisions of "RXN-15043"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
−
** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** pregn-5-ene-3,20-dione-17-ol
+
** L-lysine biosynthesis II
−
* molecular weight:
+
−
** 330.466   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''6''' reaction(s) found
−
== Reaction(s) of unknown directionality ==
+
** [[RXN-14014]]
−
* [[RXN66-350]]
+
** [[DIAMINOPIMEPIM-RXN]]
 +
** [[DIHYDRODIPICSYN-RXN]]
 +
** [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
** [[ASPARTATEKIN-RXN]]
 +
** [[DIAMINOPIMDECARB-RXN]]
 +
== Reaction(s) not found ==
 +
* '''3''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLDIAMINOPIMELATE-DEACETYLASE-RXN N-ACETYLDIAMINOPIMELATE-DEACETYLASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.89-RXN 2.3.1.89-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-4822 RXN-4822]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950]
+
{{#set: common name=L-lysine biosynthesis II}}
−
{{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}}
+
{{#set: reaction found=6}}
−
{{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}}
+
{{#set: reaction not found=3}}
−
{{#set: common name=pregn-5-ene-3,20-dione-17-ol}}
+
−
{{#set: molecular weight=330.466    }}
+
−
{{#set: consumed or produced by=RXN66-350}}
+

Revision as of 10:48, 18 January 2018

Pathway PWY-2941

  • taxonomic range:
  • common name:
    • L-lysine biosynthesis II
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-15043&oldid=4747"