Difference between revisions of "PWY0-1545"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00006799001_1 == * Synonym(s): == Reactions associated == * 2.7.1.68-RXN ** pantograph-a.taliana == Pathways associated == * PWY-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00006799001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
 +
* smiles:
 +
** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
 +
* inchi key:
 +
** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
 +
* common name:
 +
** pregn-5-ene-3,20-dione-17-ol
 +
* molecular weight:
 +
** 330.466   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.7.1.68-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[a.taliana]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RXN66-350]]
* [[PWY-6352]]
+
* [[PWY-6351]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=2.7.1.68-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6352|PWY-6351}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950]
 +
{{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}}
 +
{{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}}
 +
{{#set: common name=pregn-5-ene-3,20-dione-17-ol}}
 +
{{#set: molecular weight=330.466    }}
 +
{{#set: consumed or produced by=RXN66-350}}

Revision as of 10:48, 18 January 2018

Metabolite CPD66-27

  • smiles:
    • CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
  • inchi key:
    • InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
  • common name:
    • pregn-5-ene-3,20-dione-17-ol
  • molecular weight:
    • 330.466
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links