Difference between revisions of "PWY-7343"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * smiles: ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7784 RXN-7784] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7784 RXN-7784] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.1.1.219 EC-1.1.1.219] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CPD-7087]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-7088]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 (+)-dihydromyricetin[c] '''+''' 2 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 (2R,3S,4S)-leucodelphinidin[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[CHC_T00009538001_1]] | ||
| + | ** [[pantograph]]-[[a.taliana]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5152]], leucodelphinidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5152 PWY-5152] | ||
| + | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[a.taliana]] | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-RXN: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05038 R05038] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | {{#set: | + | {{#set: ec number=EC-1.1.1.219}} |
| − | {{#set: | + | {{#set: gene associated=CHC_T00009538001_1}} |
| − | {{#set: | + | {{#set: in pathway=PWY-5152}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| + | {{#set: reconstruction source=a.taliana}} | ||
Revision as of 10:49, 18 January 2018
Contents
Reaction RXN-7784
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 (+)-dihydromyricetin[c] + 2 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 (2R,3S,4S)-leucodelphinidin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5152, leucodelphinidin biosynthesis: PWY-5152
- 1 reactions found over 5 reactions in the full pathway
Reconstruction information
External links
- LIGAND-RXN:
