Difference between revisions of "GLYOX"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14120 RXN-14120] == * direction: ** REVERSIBLE * common name: ** nucleoside-diphosphate kinase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) |
+ | * inchi key: | ||
+ | ** InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N | ||
* common name: | * common name: | ||
− | ** | + | ** ubiquinol-9 |
− | * | + | * molecular weight: |
− | ** | + | ** 797.255 |
* Synonym(s): | * Synonym(s): | ||
+ | ** ubiquinol(9) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.1.1.64-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45281170 45281170] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84424 84424] |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} |
− | + | {{#set: inchi key=InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N}} | |
− | + | {{#set: common name=ubiquinol-9}} | |
− | + | {{#set: molecular weight=797.255 }} | |
− | + | {{#set: common name=ubiquinol(9)}} | |
− | {{#set: | + | {{#set: produced by=2.1.1.64-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 10:49, 18 January 2018
Contents
Metabolite CPD-9957
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- inchi key:
- InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N
- common name:
- ubiquinol-9
- molecular weight:
- 797.255
- Synonym(s):
- ubiquinol(9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links