Difference between revisions of "RXN-16042"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
 
(Created page with "Category:Gene == Gene CHC_T00008575001 == * left end position: ** 166944 * transcription direction: ** NEGATIVE * right end position: ** 168494 * centisome position: ** 37...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Gene CHC_T00008575001 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
+
** 166944
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** shikimate 3-phosphate
+
** 168494
−
* molecular weight:
+
* centisome position:
−
** 251.109    
+
** 37.817192    
 
* Synonym(s):
 
* Synonym(s):
−
** shikimate 5-phosphate
 
−
** shikimate-5-P
 
−
** 3-phosphoshikimate
 
−
** shikimate-3-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[SUCCSEMIALDDEHYDROG-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** original_genome
−
* [[2.5.1.19-RXN]]
+
***automated-name-match
−
* [[SHIKIMATE-KINASE-RXN]]
+
== Pathways associated ==
 +
* [[PWY-6537]]
 +
* [[3-HYDROXYPHENYLACETATE-DEGRADATION-PWY]]
 +
* [[PWY-6993]]
 +
* [[P105-PWY]]
 +
* [[P181-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=166944}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=168494}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
+
{{#set: centisome position=37.817192   }}
−
* BIGG : skm5p
+
{{#set: reaction associated=SUCCSEMIALDDEHYDROG-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6537|3-HYDROXYPHENYLACETATE-DEGRADATION-PWY|PWY-6993|P105-PWY|P181-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
+
−
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
+
−
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
+
−
{{#set: common name=shikimate 3-phosphate}}
+
−
{{#set: molecular weight=251.109   }}
+
−
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
+
−
{{#set: consumed or produced by=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}
+

Revision as of 11:49, 18 January 2018

Gene CHC_T00008575001

  • left end position:
    • 166944
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 168494
  • centisome position:
    • 37.817192
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-16042&oldid=4936"