Difference between revisions of "RXN-15733"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * smiles: ** C1(=O)(C(O)C(O)[CH](C(O)C=O)O1) * inchi...") |
(Created page with "Category:Gene == Gene CHC_T00008357001_1 == * Synonym(s): == Reactions associated == * ACETYLGLUTKIN-RXN ** pantograph-a.taliana * N-ACETYLTRANSFER-RXN **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008357001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ACETYLGLUTKIN-RXN]] | |
− | == | + | ** [[pantograph]]-[[a.taliana]] |
− | * [[ | + | * [[N-ACETYLTRANSFER-RXN]] |
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[RXN0-6948]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5154]] | ||
+ | * [[GLUTORN-PWY]] | ||
+ | * [[ARGSYNBSUB-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=ACETYLGLUTKIN-RXN|N-ACETYLTRANSFER-RXN|RXN0-6948}} | |
− | + | {{#set: pathway associated=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 10:50, 18 January 2018
Gene CHC_T00008357001_1
- Synonym(s):