Difference between revisions of "PHOSMANMUT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00005267001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00005267001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
 +
* smiles:
 +
** C(=O)([O-])C(O)C(O)C(O)CCl
 +
* inchi key:
 +
** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
 +
* common name:
 +
** 5-chloro-5-deoxy-D-ribonate
 +
* molecular weight:
 +
** 183.568   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-11717]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707]
 +
{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}}
 +
{{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}}
 +
{{#set: common name=5-chloro-5-deoxy-D-ribonate}}
 +
{{#set: molecular weight=183.568    }}
 +
{{#set: consumed by=RXN-11717}}

Revision as of 10:50, 18 January 2018

Metabolite CPD-12673

  • smiles:
    • C(=O)([O-])C(O)C(O)C(O)CCl
  • inchi key:
    • InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
  • common name:
    • 5-chloro-5-deoxy-D-ribonate
  • molecular weight:
    • 183.568
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C(O)C(O)C(O)CCl" cannot be used as a page name in this wiki.