Difference between revisions of "COLANSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064] ==
* smiles:
+
* taxonomic range:
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
+
 
* common name:
 
* common name:
** avenasterol
+
** chlorophyll a biosynthesis II
* molecular weight:
+
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-4209]]
+
* '''5''' reaction(s) found
== Reaction(s) known to produce the compound ==
+
** [[RXN-7666]]
== Reaction(s) of unknown directionality ==
+
** [[RXN-7663]]
 +
** [[RXN-7664]]
 +
** [[RXN-7665]]
 +
** [[RXN-5286]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5064 PWY-5064]
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
+
{{#set: common name=chlorophyll a biosynthesis II}}
* HMDB : HMDB06851
+
{{#set: reaction found=5}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction not found=0}}
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
+
{{#set: common name=avenasterol}}
+
{{#set: molecular weight=412.698    }}
+
{{#set: consumed by=RXN-4209}}
+

Revision as of 10:50, 18 January 2018

Pathway PWY-5064

  • taxonomic range:
  • common name:
    • chlorophyll a biosynthesis II
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links