Difference between revisions of "PWY-7255"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
 
(Created page with "Category:Gene == Gene CHC_T00004794001_1 == * Synonym(s): == Reactions associated == * GLYCINE--TRNA-LIGASE-RXN ** pantograph-galdieria.sulphuraria == Pathway...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Gene CHC_T00004794001_1 ==
* smiles:
+
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
* inchi key:
+
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
* common name:
+
** 14-oxolanosterol
+
* molecular weight:
+
** 440.708   
+
 
* Synonym(s):
 
* Synonym(s):
** 14-oxo-lanosterol
 
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-305]]
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[galdieria.sulphuraria]]
* [[RXN66-304]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[TRNA-CHARGING-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=GLYCINE--TRNA-LIGASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
+
{{#set: pathway associated=TRNA-CHARGING-PWY}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: common name=14-oxolanosterol}}
+
{{#set: molecular weight=440.708    }}
+
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-305}}
+
{{#set: produced by=RXN66-304}}
+

Revision as of 10:50, 18 January 2018

Gene CHC_T00004794001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links