Difference between revisions of "CPD-9973"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Gene == Gene CHC_T00008422001 == * left end position: ** 262956 * transcription direction: ** POSITIVE * right end position: ** 267122 * centisome position: ** 85...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008422001 == |
− | * | + | * left end position: |
− | ** | + | ** 262956 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 267122 |
− | * | + | * centisome position: |
− | ** | + | ** 85.3756 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | == | + | * [[RXN1F-20]] |
− | * [[ | + | ** original_genome |
− | * [[ | + | ***automated-name-match |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-5531]] |
+ | * [[CHLOROPHYLL-SYN]] | ||
+ | * [[PWY-7159]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=262956}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=267122}} | |
− | + | {{#set: centisome position=85.3756 }} | |
− | + | {{#set: reaction associated=RXN1F-20}} | |
− | + | {{#set: pathway associated=PWY-5531|CHLOROPHYLL-SYN|PWY-7159}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 10:51, 18 January 2018
Gene CHC_T00008422001
- left end position:
- 262956
- transcription direction:
- POSITIVE
- right end position:
- 267122
- centisome position:
- 85.3756
- Synonym(s):
Reactions associated
- RXN1F-20
- original_genome
- automated-name-match
- original_genome