Difference between revisions of "PWY-7591"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=F16BDEPHOS-RXN F16BDEPHOS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** fructose-1,6-bisp...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMIMINO-AICAR-P PHOSPHORIBOSYL-FORMIMINO-AICAR-P] == * smiles: ** C(NC1(OC(COP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMIMINO-AICAR-P PHOSPHORIBOSYL-FORMIMINO-AICAR-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(NC1(OC(COP([O-])(=O)[O-])C(O)C(O)1))=NC3(=C(C(N)=O)N=CN(C2(OC(COP([O-])(=O)[O-])C(O)C(O)2))3) |
+ | * inchi key: | ||
+ | ** InChIKey=QOUSHGMTBIIAHR-KEOHHSTQSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 1-(5-phospho-β-D-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide |
− | + | * molecular weight: | |
− | * | + | ** 573.303 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** phosphoribosylformiminoAICAR-phosphate | ||
+ | ** phosphoribosyl-formimino-aicar-P | ||
+ | ** phosphoribosylformiminoAICAR-P | ||
+ | ** 5-(5-phospho-D-ribosyl-aminoformimino)-1-(5-phosphoribosyl)-imidazole4-carboxamide | ||
+ | ** 5-(5'-phospho-D-ribosyl-aminoformimino)-1-(5-phosphoribosyl)-imidazole-4-carboxamide | ||
+ | ** N-5-phosphoribosyl-formimino-5-amino-imidazole-4-carboxamide ribonucleotide | ||
+ | ** N-(5'-phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazolecarboxamide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[PRIBFAICARPISOM-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[HISTCYCLOHYD-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04896 C04896] | |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58435 58435] |
− | * | + | * BIGG : prfp |
− | ** [http://www. | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266644 45266644] | |
− | + | * HMDB : HMDB12277 | |
− | * | + | {{#set: smiles=C(NC1(OC(COP([O-])(=O)[O-])C(O)C(O)1))=NC3(=C(C(N)=O)N=CN(C2(OC(COP([O-])(=O)[O-])C(O)C(O)2))3)}} |
− | * | + | {{#set: inchi key=InChIKey=QOUSHGMTBIIAHR-KEOHHSTQSA-J}} |
− | ** [http:// | + | {{#set: common name=1-(5-phospho-β-D-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}} |
− | + | {{#set: molecular weight=573.303 }} | |
− | + | {{#set: common name=phosphoribosylformiminoAICAR-phosphate|phosphoribosyl-formimino-aicar-P|phosphoribosylformiminoAICAR-P|5-(5-phospho-D-ribosyl-aminoformimino)-1-(5-phosphoribosyl)-imidazole4-carboxamide|5-(5'-phospho-D-ribosyl-aminoformimino)-1-(5-phosphoribosyl)-imidazole-4-carboxamide|N-5-phosphoribosyl-formimino-5-amino-imidazole-4-carboxamide ribonucleotide|N-(5'-phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazolecarboxamide}} | |
− | * | + | {{#set: consumed by=PRIBFAICARPISOM-RXN}} |
− | + | {{#set: produced by=HISTCYCLOHYD-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 11:51, 18 January 2018
Contents
Metabolite PHOSPHORIBOSYL-FORMIMINO-AICAR-P
- smiles:
- C(NC1(OC(COP([O-])(=O)[O-])C(O)C(O)1))=NC3(=C(C(N)=O)N=CN(C2(OC(COP([O-])(=O)[O-])C(O)C(O)2))3)
- inchi key:
- InChIKey=QOUSHGMTBIIAHR-KEOHHSTQSA-J
- common name:
- 1-(5-phospho-β-D-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
- molecular weight:
- 573.303
- Synonym(s):
- phosphoribosylformiminoAICAR-phosphate
- phosphoribosyl-formimino-aicar-P
- phosphoribosylformiminoAICAR-P
- 5-(5-phospho-D-ribosyl-aminoformimino)-1-(5-phosphoribosyl)-imidazole4-carboxamide
- 5-(5'-phospho-D-ribosyl-aminoformimino)-1-(5-phosphoribosyl)-imidazole-4-carboxamide
- N-5-phosphoribosyl-formimino-5-amino-imidazole-4-carboxamide ribonucleotide
- N-(5'-phospho-D-ribosylformimino)-5-amino-1-(5-phosphoribosyl)-4-imidazolecarboxamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(OC(COP([O-])(=O)[O-])C(O)C(O)1))=NC3(=C(C(N)=O)N=CN(C2(OC(COP([O-])(=O)[O-])C(O)C(O)2))3)" cannot be used as a page name in this wiki.
"1-(5-phospho-β-D-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide" cannot be used as a page name in this wiki.