|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-TYROSINE-PHOSPHATASE-RXN PROTEIN-TYROSINE-PHOSPHATASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/3.1.3.48 EC-3.1.3.48] | + | ** InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J |
| + | * common name: |
| + | ** isobutanoyl-CoA |
| + | * molecular weight: |
| + | ** 833.593 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 2-methylpropanoyl-CoA |
| + | ** isobutyryl-coenzyme A |
| + | ** 2-methylpropionyl-CoA |
| + | ** S-(2-methylpropanoyl)-CoA |
| + | ** isobutyryl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[Protein-tyrosine-phosphates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Protein-Tyrosines]][c]
| + | * [[1.2.1.25-RXN]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 a [protein]-L-tyrosine phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 a [protein]-L-tyrosine[c] | + | * [[2.3.1.168-RXN]] |
− | | + | * [[ISOBUTYRYL-COA-MUTASE-RXN]] |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00004298001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00006530001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00002485001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00008580001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | == Pathways ==
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * CAS : 15621-60-0 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02585 R02585]
| + | * PUBCHEM: |
− | * UNIPROT: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266570 45266570] |
− | ** [http://www.uniprot.org/uniprot/P06800 P06800] | + | * HMDB : HMDB01243 |
− | ** [http://www.uniprot.org/uniprot/P20483 P20483]
| + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P23748 P23748]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00630 C00630] |
− | ** [http://www.uniprot.org/uniprot/P20417 P20417] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P18433 P18433] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57338 57338] |
− | ** [http://www.uniprot.org/uniprot/P24666 P24666] | + | * METABOLIGHTS : MTBLC57338 |
− | ** [http://www.uniprot.org/uniprot/Q06180 Q06180] | + | {{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}} |
− | ** [http://www.uniprot.org/uniprot/P30307 P30307] | + | {{#set: inchi key=InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P25044 P25044]
| + | {{#set: common name=isobutanoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P27574 P27574]
| + | {{#set: molecular weight=833.593 }} |
− | ** [http://www.uniprot.org/uniprot/P29074 P29074] | + | {{#set: common name=2-methylpropanoyl-CoA|isobutyryl-coenzyme A|2-methylpropionyl-CoA|S-(2-methylpropanoyl)-CoA|isobutyryl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P26045 P26045]
| + | {{#set: produced by=1.2.1.25-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P35234 P35234]
| + | {{#set: consumed or produced by=2.3.1.168-RXN|ISOBUTYRYL-COA-MUTASE-RXN}} |
− | ** [http://www.uniprot.org/uniprot/P35832 P35832]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30304 P30304]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03019 Q03019]
| + | |
− | ** [http://www.uniprot.org/uniprot/P11064 P11064]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30306 P30306]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30309 P30309]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43378 P43378]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29349 P29349]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29351 P29351]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W0G1 Q9W0G1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23471 P23471]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35235 P35235]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08575 P08575]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18052 P18052]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35822 P35822]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23470 P23470]
| + | |
− | ** [http://www.uniprot.org/uniprot/P34138 P34138]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q24495 Q24495]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9W4F5 Q9W4F5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q15426 Q15426]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41499 P41499]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q28613 Q28613]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q28182 Q28182]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15273 P15273]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91870 Q91870]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91976 Q91976]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12923 Q12923]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41893 P41893]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62132 Q62132]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92124 Q92124]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23468 P23468]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62917 Q62917]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64696 Q64696]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40347 P40347]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16620 P16620]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30305 P30305]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29352 P29352]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05909 Q05909]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91871 Q91871]
| + | |
− | ** [http://www.uniprot.org/uniprot/P49446 P49446]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CDL7 Q9CDL7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30311 P30311]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64487 Q64487]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JU65 Q9JU65]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35992 P35992]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AAB2 P0AAB2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PN39 Q9PN39]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16825 Q16825]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12913 Q12913]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48967 P48967]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60998 Q60998]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90815 Q90815]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90816 Q90816]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90817 Q90817]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30310 P30310]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62604 Q62604]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64605 Q64605]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05209 Q05209]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60673 Q60673]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62130 Q62130]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q15678 Q15678]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92932 Q92932]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q90687 Q90687]
| + | |
− | ** [http://www.uniprot.org/uniprot/P79923 P79923]
| + | |
− | ** [http://www.uniprot.org/uniprot/O00197 O00197]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q61042 Q61042]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ERM5 Q9ERM5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35236 P35236]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35821 P35821]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q06124 Q06124]
| + | |
− | ** [http://www.uniprot.org/uniprot/O13016 O13016]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23467 P23467]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23469 P23469]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35233 P35233]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30634 P30634]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28827 P28827]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28828 P28828]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64497 Q64497]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29350 P29350]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30303 P30303]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32586 P32586]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32587 P32587]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02256 Q02256]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8VBV0 Q8VBV0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8R169 Q8R169]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64512 Q64512]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q29029 Q29029]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38148 P38148]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64604 Q64604]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q63745 Q63745]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39155 P39155]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64494 Q64494]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62728 Q62728]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64502 Q64502]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64504 Q64504]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46630 Q46630]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q17024 Q17024]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35831 P35831]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00684 Q00684]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16827 Q16827]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06652 P06652]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29461 P29461]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q29500 Q29500]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q62370 Q62370]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92735 Q92735]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q45408 Q45408]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82710 O82710]
| + | |
− | ** [http://www.uniprot.org/uniprot/O88488 O88488]
| + | |
− | ** [http://www.uniprot.org/uniprot/O88902 O88902]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94044 O94044]
| + | |
− | ** [http://www.uniprot.org/uniprot/O44329 O44329]
| + | |
− | ** [http://www.uniprot.org/uniprot/O76282 O76282]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q98936 Q98936]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91054 Q91054]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q22582 Q22582]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39491 Q39491]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65190 O65190]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16621 P16621]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10586 P10586]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64224 Q64224]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18031 P18031]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: ec number=EC-3.1.3.48}} | + | |
− | {{#set: gene associated=CHC_T00004298001_1|CHC_T00006530001_1|CHC_T00002485001_1|CHC_T00008580001_1}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=galdieria.sulphuraria}}
| + | |