Difference between revisions of "RXN-9680"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8607 CPD-8607] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(CO)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8606 CPD-8606] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8606 CPD-8606] == |
* smiles: | * smiles: | ||
| − | ** CC(C)CCCC([CH]4(C1(C)(C( | + | ** CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 24,25-dihydrolanosterol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 428.74 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol | ||
| + | ** 5alpha-lanost-8-en-3beta-ol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
* [[RXN66-11]] | * [[RXN66-11]] | ||
| + | * [[RXN-13707]] | ||
| + | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440560 440560] |
| + | * HMDB : HMDB06839 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05109 C05109] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5140691.html 5140691] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28113 28113] |
| − | * | + | * METABOLIGHTS : MTBLC28113 |
| − | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C( | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N}} |
| − | {{#set: common name=4,4 | + | {{#set: common name=24,25-dihydrolanosterol}} |
| − | + | {{#set: molecular weight=428.74 }} | |
| − | {{#set: consumed by=RXN66- | + | {{#set: common name=4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol|5alpha-lanost-8-en-3beta-ol}} |
| − | + | {{#set: consumed by=RXN66-11|RXN-13707}} | |
Revision as of 10:52, 18 January 2018
Contents
Metabolite CPD-8606
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- inchi key:
- InChIKey=MBZYKEVPFYHDOH-BQNIITSRSA-N
- common name:
- 24,25-dihydrolanosterol
- molecular weight:
- 428.74
- Synonym(s):
- 4,4,14α-trimethyl-5α-cholesta-8-en-3β-ol
- 5alpha-lanost-8-en-3beta-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB06839
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC28113
"CC(C)CCCC([CH]4(C1(C)(C(C)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
