Difference between revisions of "PWY-5082"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTMPKI-RXN DTMPKI-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NONAPRENYL-4-HYDROXYBENZOATE NONAPRENYL-4-HYDROXYBENZOATE] == * smiles: ** CC(=CCCC(=CCCC(=CCCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NONAPRENYL-4-HYDROXYBENZOATE NONAPRENYL-4-HYDROXYBENZOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YKKKMRBEPIZPBH-XWEAJCOCSA-M |
− | ** | + | * common name: |
− | ** | + | ** 3-nonaprenyl-4-hydroxybenzoate |
+ | * molecular weight: | ||
+ | ** 750.178 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-solanesyl-4-hydroxybenzoate | ||
+ | ** nonaprenyl-4-hydroxybenzoic acid | ||
+ | ** 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl ester | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.5.1.39-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54746221 54746221] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84502 84502] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03885 C03885] | |
− | + | * HMDB : HMDB32488 | |
− | * | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=YKKKMRBEPIZPBH-XWEAJCOCSA-M}} |
− | * | + | {{#set: common name=3-nonaprenyl-4-hydroxybenzoate}} |
− | + | {{#set: molecular weight=750.178 }} | |
− | + | {{#set: common name=3-solanesyl-4-hydroxybenzoate|nonaprenyl-4-hydroxybenzoic acid|3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl ester}} | |
− | + | {{#set: produced by=2.5.1.39-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 11:52, 18 January 2018
Contents
Metabolite NONAPRENYL-4-HYDROXYBENZOATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=YKKKMRBEPIZPBH-XWEAJCOCSA-M
- common name:
- 3-nonaprenyl-4-hydroxybenzoate
- molecular weight:
- 750.178
- Synonym(s):
- 3-solanesyl-4-hydroxybenzoate
- nonaprenyl-4-hydroxybenzoic acid
- 3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(O)C=CC(C(=O)[O-])=C1))C)C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.