Difference between revisions of "RXN-8620"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L |
* common name: | * common name: | ||
| − | ** | + | ** biliverdin-IX-α |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 580.639 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dehydrobilirubin |
| + | ** uteroverdine | ||
| + | ** biliverdine | ||
| + | ** biliverdin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1.3.7.2-RXN]] |
| + | * [[1.3.7.4-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00500 C00500] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57991 57991] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC57991 |
| − | {{#set: molecular weight= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245769 25245769] |
| − | {{#set: consumed by=RXN- | + | * HMDB : HMDB01008 |
| + | {{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | ||
| + | {{#set: inchi key=InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L}} | ||
| + | {{#set: common name=biliverdin-IX-α}} | ||
| + | {{#set: molecular weight=580.639 }} | ||
| + | {{#set: common name=dehydrobilirubin|uteroverdine|biliverdine|biliverdin}} | ||
| + | {{#set: consumed by=1.3.7.2-RXN|1.3.7.4-RXN}} | ||
| + | {{#set: produced by=HEME-OXYGENASE-DECYCLIZING-RXN}} | ||
Revision as of 10:52, 18 January 2018
Contents
Metabolite BILIVERDINE
- smiles:
- C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- inchi key:
- InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L
- common name:
- biliverdin-IX-α
- molecular weight:
- 580.639
- Synonym(s):
- dehydrobilirubin
- uteroverdine
- biliverdine
- biliverdin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.
