Difference between revisions of "PWY-5794"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009073001_1 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** pantograph-a.taliana * ATPSYN-RXN ** pantograph-[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == |
| + | * smiles: | ||
| + | ** C(S([O-])=O)C(=O)C(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** 3-sulfinopyruvate | ||
| + | * molecular weight: | ||
| + | ** 150.106 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-sulphinyl-pyruvate | ||
| + | ** β-sulfinylpyruvate | ||
| + | ** 3-sulfinyl-pyruvate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05527 C05527] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1665 1665] | ||
| + | * METABOLIGHTS : MTBLC1665 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244536 25244536] | ||
| + | * HMDB : HMDB02332 | ||
| + | {{#set: smiles=C(S([O-])=O)C(=O)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=3-sulfinopyruvate}} | ||
| + | {{#set: molecular weight=150.106 }} | ||
| + | {{#set: common name=3-sulphinyl-pyruvate|β-sulfinylpyruvate|3-sulfinyl-pyruvate}} | ||
| + | {{#set: consumed or produced by=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}} | ||
Revision as of 10:52, 18 January 2018
Contents
Metabolite 3-SULFINYL-PYRUVATE
- smiles:
- C(S([O-])=O)C(=O)C(=O)[O-]
- inchi key:
- InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L
- common name:
- 3-sulfinopyruvate
- molecular weight:
- 150.106
- Synonym(s):
- 3-sulphinyl-pyruvate
- β-sulfinylpyruvate
- 3-sulfinyl-pyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(S([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.
