Difference between revisions of "MALTOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
 
* common name:
 
* common name:
** 3-oxododecanoyl-CoA
+
** 1,5-anhydrofructose degradation
* molecular weight:
+
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxolauroyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
* '''3''' reaction(s) found
== Reaction(s) of unknown directionality ==
+
** [[RXN-13064]]
* [[RXN-14274]]
+
** [[MANNPISOM-RXN]]
 +
** [[PGLUCISOM-RXN]]
 +
== Reaction(s) not found ==
 +
* '''2''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.292-RXN 1.1.1.292-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN MANNKIN-RXN]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
{{#set: common name=1,5-anhydrofructose degradation}}
* CHEBI:
+
{{#set: reaction found=3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
{{#set: reaction not found=2}}
* BIGG : 3oddcoa
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
* HMDB : HMDB03937
+
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
{{#set: common name=3-oxododecanoyl-CoA}}
+
{{#set: molecular weight=959.791    }}
+
{{#set: common name=3-oxolauroyl-CoA}}
+
{{#set: consumed or produced by=RXN-14274}}
+

Revision as of 10:52, 18 January 2018

Pathway PWY-6992

  • taxonomic range:
  • common name:
    • 1,5-anhydrofructose degradation
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links