Difference between revisions of "ACYLCOASYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4-COUMARATE--COA-LIGASE-RXN 4-COUMARATE--COA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec numb...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4-COUMARATE--COA-LIGASE-RXN 4-COUMARATE--COA-LIGASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C=CC1(=C(C=CC=C1)O))(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/6.2.1.12 EC-6.2.1.12]
+
** InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M
 +
* common name:
 +
** coumarinate
 +
* molecular weight:
 +
** 163.152   
 
* Synonym(s):
 
* Synonym(s):
 +
** coumarinic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[COUMARATE]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[P-COUMAROYL-COA]][c]
+
* [[RXN-8036]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 4-coumarate[c] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 4-coumaroyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008472001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00008160001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-6920]], 6-gingerol analog biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6920 PWY-6920]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6435]], 4-hydroxybenzoate biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY1F-FLAVSYN]], flavonoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1F-FLAVSYN PWY1F-FLAVSYN]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7046]], 4-coumarate degradation (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7046 PWY-7046]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6982]], umbelliferone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6982 PWY-6982]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7397]], naringenin biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7397 PWY-7397]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-6320]], phaselate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6320 PWY-6320]
+
−
** '''1''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7398]], coumarins biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7398 PWY-7398]
+
−
** '''3''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY-5754]], 4-hydroxybenzoate biosynthesis I (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754]
+
−
** '''2''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-5135]], xanthohumol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5135 PWY-5135]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
+
−
** '''6''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19641 19641]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54714352 54714352]
−
* LIGAND-RXN:
+
* HMDB : HMDB41592
−
** [http://www.genome.jp/dbget-bin/www_bget?R01616 R01616]
+
* LIGAND-CPD:
−
* UNIPROT:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05838 C05838]
−
** [http://www.uniprot.org/uniprot/P31684 P31684]
+
* CHEMSPIDER:
−
** [http://www.uniprot.org/uniprot/P31685 P31685]
+
** [http://www.chemspider.com/Chemical-Structure.20118034.html 20118034]
−
** [http://www.uniprot.org/uniprot/Q9SWH8 Q9SWH8]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9SWH7 Q9SWH7]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47921 47921]
−
** [http://www.uniprot.org/uniprot/P17814 P17814]
+
* METABOLIGHTS : MTBLC47921
−
** [http://www.uniprot.org/uniprot/P31687 P31687]
+
{{#set: smiles=C(C=CC1(=C(C=CC=C1)O))(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/Q8S5C2 Q8S5C2]
+
{{#set: inchi key=InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M}}
−
** [http://www.uniprot.org/uniprot/P14912 P14912]
+
{{#set: common name=coumarinate}}
−
** [http://www.uniprot.org/uniprot/P14913 P14913]
+
{{#set: molecular weight=163.152    }}
−
** [http://www.uniprot.org/uniprot/P31686 P31686]
+
{{#set: common name=coumarinic acid}}
−
** [http://www.uniprot.org/uniprot/Q42524 Q42524]
+
{{#set: produced by=RXN-8036}}
−
** [http://www.uniprot.org/uniprot/Q42943 Q42943]
+
−
** [http://www.uniprot.org/uniprot/Q42982 Q42982]
+
−
** [http://www.uniprot.org/uniprot/P93360 P93360]
+
−
** [http://www.uniprot.org/uniprot/P93361 P93361]
+
−
** [http://www.uniprot.org/uniprot/O24146 O24146]
+
−
** [http://www.uniprot.org/uniprot/O48868 O48868]
+
−
** [http://www.uniprot.org/uniprot/O48869 O48869]
+
−
** [http://www.uniprot.org/uniprot/O81139 O81139]
+
−
** [http://www.uniprot.org/uniprot/O81140 O81140]
+
−
** [http://www.uniprot.org/uniprot/P41636 P41636]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-6.2.1.12}}
+
−
{{#set: gene associated=CHC_T00008472001_1|CHC_T00008160001_1}}
+
−
{{#set: in pathway=PWY-6920|PWY-6435|PWY1F-FLAVSYN|PWY-7046|PWY-6982|PWY-7397|PWY-6320|PWY-7398|PWY-5754|PWY-5135|PWY-361}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=a.taliana}}
+

Revision as of 10:52, 18 January 2018

Metabolite CPD-7418

  • smiles:
    • C(C=CC1(=C(C=CC=C1)O))(=O)[O-]
  • inchi key:
    • InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M
  • common name:
    • coumarinate
  • molecular weight:
    • 163.152
  • Synonym(s):
    • coumarinic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C=CC1(=C(C=CC=C1)O))(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=ACYLCOASYN-RXN&oldid=5269"