Difference between revisions of "SULFO-CYSTEINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12448 RXN-12448] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12448 RXN-12448] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.1.1.1 EC-1.1.1.1]
+
** chlorophyllide b
 +
* molecular weight:
 +
** 626.95   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7674]]
−
** 1 [[Secondary-Alcohols]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[LONG-CHAIN-KETONE]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a secondary alcohol[c] '''+''' 1 NAD+[c] '''<=>''' 1 NADH[c] '''+''' 1 a ketone[c] '''+''' 1 H+[c]
+
* [[RXN-7673]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00010066001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10743 10743]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00624 R00624]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.1.1.1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
−
{{#set: gene associated=CHC_T00010066001_1}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
{{#set: in pathway=}}
+
{{#set: common name=chlorophyllide b}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=626.95    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-7674}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: consumed or produced by=RXN-7673}}

Revision as of 10:53, 18 January 2018

Metabolite CPD-7014

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • chlorophyllide b
  • molecular weight:
    • 626.95
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=SULFO-CYSTEINE&oldid=5301"