Difference between revisions of "RXN-14240"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] == * smiles: ** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5337 PWY-5337] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5337 PWY-5337] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** stachyose biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** raffinose biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''2''' reaction(s) found | |
− | * [[ | + | ** [[2.4.1.67-RXN]] |
− | == Reaction(s) | + | ** [[2.4.1.82-RXN]] |
+ | == Reaction(s) not found == | ||
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.123-RXN 2.4.1.123-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5337 PWY-5337] |
− | + | {{#set: taxonomic range=TAX-3398}} | |
− | + | {{#set: common name=stachyose biosynthesis}} | |
− | + | {{#set: common name=raffinose biosynthesis}} | |
− | {{#set: | + | {{#set: reaction found=2}} |
− | {{#set: common name= | + | {{#set: reaction not found=1}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 10:53, 18 January 2018
Pathway PWY-5337
- taxonomic range:
- common name:
- stachyose biosynthesis
- Synonym(s):
- raffinose biosynthesis
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ARACYC: