Difference between revisions of "RXN-12454"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13758 CPD-13758] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)...")
 
(Created page with "Category:Gene == Gene CHC_T00009113001 == * left end position: ** 141109 * transcription direction: ** POSITIVE * right end position: ** 142593 * centisome position: ** 65...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13758 CPD-13758] ==
+
== Gene CHC_T00009113001 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** 141109
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OGAHROYMEOBORV-XONGILKKSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-oxopropanoyl-CoA
+
** 142593
−
* molecular weight:
+
* centisome position:
−
** 999.769    
+
** 65.53730    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-12750]]
+
** original_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=141109}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657507 90657507]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: right end position=142593}}
−
{{#set: inchi key=InChIKey=OGAHROYMEOBORV-XONGILKKSA-J}}
+
{{#set: centisome position=65.53730   }}
−
{{#set: common name=3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-oxopropanoyl-CoA}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: molecular weight=999.769   }}
+
−
{{#set: produced by=RXN-12750}}
+

Revision as of 10:53, 18 January 2018

Gene CHC_T00009113001

  • left end position:
    • 141109
  • transcription direction:
    • POSITIVE
  • right end position:
    • 142593
  • centisome position:
    • 65.53730
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12454&oldid=5305"