Difference between revisions of "P224-PWY"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009101001_1 == * Synonym(s): == Reactions associated == * RXN-14917 ** pantograph-galdieria.sulphuraria * RXN-2542 ** panto...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8848 CPD-8848] == * smiles: ** C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O * common name: ** (E,E)-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8848 CPD-8848] == |
| + | * smiles: | ||
| + | ** C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O | ||
| + | * common name: | ||
| + | ** (E,E)-geranyllinalool | ||
| + | * inchi key: | ||
| + | ** InChIKey=IQDXAJNQKSIPGB-HQSZAHFGSA-N | ||
| + | * molecular weight: | ||
| + | ** 290.488 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** (6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-8620]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[RXN-10441]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20681 C20681] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4517814.html 4517814] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74299 74299] | ||
| + | * METABOLIGHTS : MTBLC74299 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5365872 5365872] | ||
| + | {{#set: smiles=C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O}} | ||
| + | {{#set: common name=(E,E)-geranyllinalool}} | ||
| + | {{#set: inchi key=InChIKey=IQDXAJNQKSIPGB-HQSZAHFGSA-N}} | ||
| + | {{#set: molecular weight=290.488 }} | ||
| + | {{#set: common name=(6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol}} | ||
| + | {{#set: consumed by=RXN-8620}} | ||
| + | {{#set: produced by=RXN-10441}} | ||
Revision as of 10:53, 18 January 2018
Contents
Metabolite CPD-8848
- smiles:
- C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O
- common name:
- (E,E)-geranyllinalool
- inchi key:
- InChIKey=IQDXAJNQKSIPGB-HQSZAHFGSA-N
- molecular weight:
- 290.488
- Synonym(s):
- (6E,10E)-3,7,11,15-tetramethylhexadeca-1,6,10,14-tetraen-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
