Difference between revisions of "CHC T00002485001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] == * common name: ** a cis-2-enoyl-CoA * Synonym(s): ** a ci...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] ==
 +
* smiles:
 +
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
 +
* inchi key:
 +
** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
 
* common name:
 
* common name:
** a cis-2-enoyl-CoA
+
** 7-dehydrodesmosterol
 +
* molecular weight:
 +
** 382.628   
 
* Synonym(s):
 
* Synonym(s):
** a cis-2,3-dehydroacyl-CoA
+
** 5α-cholesta-5,7,24-trien-3β-ol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11887]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-17475]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a cis-2-enoyl-CoA}}
+
* PUBCHEM:
{{#set: common name=a cis-2,3-dehydroacyl-CoA}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558]
{{#set: consumed or produced by=RXN-17475}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107]
 +
* HMDB : HMDB03896
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}}
 +
{{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}}
 +
{{#set: common name=7-dehydrodesmosterol}}
 +
{{#set: molecular weight=382.628    }}
 +
{{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}}
 +
{{#set: produced by=RXN-11887}}

Revision as of 11:54, 18 January 2018

Metabolite CPD-8646

  • smiles:
    • CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
  • inchi key:
    • InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
  • common name:
    • 7-dehydrodesmosterol
  • molecular weight:
    • 382.628
  • Synonym(s):
    • 5α-cholesta-5,7,24-trien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.