Difference between revisions of "RXN-9537"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7161 PWY-7161] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-91827 TAX-9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C |
| + | * inchi key: | ||
| + | ** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** ω-saturated C55 dolichol phosphate |
| + | * molecular weight: | ||
| + | ** 849.311 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ω-saturated dolichol-11 phosphate | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-16602]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874] |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}} |
| + | {{#set: common name=ω-saturated C55 dolichol phosphate}} | ||
| + | {{#set: molecular weight=849.311 }} | ||
| + | {{#set: common name=ω-saturated dolichol-11 phosphate}} | ||
| + | {{#set: consumed by=RXN-16602}} | ||
Revision as of 10:54, 18 January 2018
Contents
Metabolite CPD-17858
- smiles:
- CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
- inchi key:
- InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
- common name:
- ω-saturated C55 dolichol phosphate
- molecular weight:
- 849.311
- Synonym(s):
- ω-saturated dolichol-11 phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.
