Difference between revisions of "PWY-5538"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] == * smiles: ** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6974 PWY-6974] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4187 CPD-4187] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
 +
* inchi key:
 +
** InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
 
* common name:
 
* common name:
−
** dTDP-L-olivose biosynthesis
+
** 7-dehydrocholesterol
 +
* molecular weight:
 +
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
 +
** cholesta-5,7-dien-3 β-ol
 +
** cholesta-5,7-dienol
 +
** 7-dehydro-cholesterol
 +
** cholesta-5,7-dien-3β-ol
 +
** provitamin D3
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
* '''1''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
−
** [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[1.14.21.6-RXN]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* '''6''' reaction(s) not found
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16262 RXN-16262]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12404 RXN-12404]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12928 RXN-12928]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12929 RXN-12929]
+
−
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12943 RXN-12943]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* CAS : 434-16-2
−
{{#set: common name=dTDP-L-olivose biosynthesis}}
+
* PUBCHEM:
−
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439423 439423]
−
{{#set: reaction not found=6}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17759 17759]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01164 C01164]
 +
* HMDB : HMDB00032
 +
{{#set: smiles=CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))}}
 +
{{#set: inchi key=InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N}}
 +
{{#set: common name=7-dehydrocholesterol}}
 +
{{#set: molecular weight=384.644    }}
 +
{{#set: common name=cholesta-5,7-dien-3 β-ol|cholesta-5,7-dienol|7-dehydro-cholesterol|cholesta-5,7-dien-3β-ol|provitamin D3}}
 +
{{#set: produced by=1.14.21.6-RXN}}

Revision as of 10:54, 18 January 2018

Metabolite CPD-4187

  • smiles:
    • CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))
  • inchi key:
    • InChIKey=UCTLRSWJYQTBFZ-DDPQNLDTSA-N
  • common name:
    • 7-dehydrocholesterol
  • molecular weight:
    • 384.644
  • Synonym(s):
    • cholesta-5,7-dien-3 β-ol
    • cholesta-5,7-dienol
    • 7-dehydro-cholesterol
    • cholesta-5,7-dien-3β-ol
    • provitamin D3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]1(CC[CH]2(C(C)1CC[CH]3(C2=CC=C4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5538&oldid=5435"