Difference between revisions of "RXN-16025"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12279 RXN-12279] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * smiles: ** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12279 RXN-12279] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.2.1.2 EC-3.2.1.2]
+
** InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
 +
* common name:
 +
** 3-trans-decenoyl-CoA
 +
* molecular weight:
 +
** 915.738   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3E-decenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** n [[WATER]][c] '''+''' 1 [[CPD-13198]][c] '''=>''' 1 [[Branched-Unphos-Amylopectin-Tails]][c] '''+''' 1 [[MALTOSE]][c]
+
* [[RXN-14803]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** n H2O[c] '''+''' 1 an exposed unphosphorylated, unbranched malto-oligosaccharide tail on amylopectin[c] '''=>''' 1 an exposed unphosphorylated, (α-1,6)-branched malto-oligosaccharide tail on amylopectin[c] '''+''' 1 maltose[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008493001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6724]], starch degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6724 PWY-6724]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-3.2.1.2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657610 90657610]
−
{{#set: gene associated=CHC_T00008493001_1}}
+
* CHEBI:
−
{{#set: in pathway=PWY-6724}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84793 84793]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=3-trans-decenoyl-CoA}}
 +
{{#set: molecular weight=915.738    }}
 +
{{#set: common name=3E-decenoyl-CoA}}
 +
{{#set: produced by=RXN-14803}}

Revision as of 11:54, 18 January 2018

Metabolite CPD-15692

  • smiles:
    • CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
  • common name:
    • 3-trans-decenoyl-CoA
  • molecular weight:
    • 915.738
  • Synonym(s):
    • 3E-decenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-16025&oldid=5442"