Difference between revisions of "Mitogen-Activated-Protein-Kinase-L-Thr"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8848 CPD-8848] == * smiles: ** C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O * common name: ** (E,E)-...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
* common name: | * common name: | ||
− | ** ( | + | ** purine nucleobases degradation I (anaerobic) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** purine fermentation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''3''' reaction(s) found |
− | == Reaction(s) | + | ** [[RXN-7682]] |
− | * [[RXN- | + | ** [[RXN0-901]] |
− | == | + | ** [[METHENYLTHFCYCLOHYDRO-RXN]] |
+ | == Reaction(s) not found == | ||
+ | * '''14''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=FORMYLTHFDEFORMYL-RXN FORMYLTHFDEFORMYL-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R127-RXN R127-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8755 RXN-8755] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=ACETATEKIN-RXN ACETATEKIN-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8752 RXN-8752] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R128-RXN R128-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R13-RXN R13-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=GUANINE-DEAMINASE-RXN GUANINE-DEAMINASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7566 RXN-7566] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R62-RXN R62-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE-FORMIMINOTRANSFERASE-RXN GLYCINE-FORMIMINOTRANSFERASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=4.3.1.4-RXN 4.3.1.4-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.2-RXN 1.2.1.2-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R63-RXN R63-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=purine nucleobases degradation I (anaerobic)}} | |
− | + | {{#set: common name=purine fermentation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=14}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name=( | + | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 10:55, 18 January 2018
Pathway P164-PWY
- taxonomic range:
- common name:
- purine nucleobases degradation I (anaerobic)
- Synonym(s):
- purine fermentation
Reaction(s) found
- 3 reaction(s) found
Reaction(s) not found
- 14 reaction(s) not found