Difference between revisions of "RXN-7651"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * smiles: ** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(Created page with "Category:Gene == Gene CHC_T00009358001 == * left end position: ** 99280 * transcription direction: ** POSITIVE * right end position: ** 100220 * centisome position: ** 69....")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Gene CHC_T00009358001 ==
* smiles:
+
* left end position:
** CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 99280
* inchi key:
+
* transcription direction:
** InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J
+
** POSITIVE
* common name:
+
* right end position:
** (S)-3-hydroxy-(7Z)-tetradecenoyl-CoA
+
** 100220
* molecular weight:
+
* centisome position:
** 987.845    
+
** 69.06099    
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-14:1-Δ7-CoA
 
** (S)-3-hydroxy-7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17794]]
+
* [[RXN-15556]]
== Reaction(s) known to produce the compound ==
+
** original_genome
* [[RXN-17793]]
+
***automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=99280}}
{{#set: inchi key=InChIKey=WGCARZJTIJIWSL-JCJYIPITSA-J}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: common name=(S)-3-hydroxy-(7Z)-tetradecenoyl-CoA}}
+
{{#set: right end position=100220}}
{{#set: molecular weight=987.845   }}
+
{{#set: centisome position=69.06099   }}
{{#set: common name=(S)-3-hydroxy-14:1-Δ7-CoA|(S)-3-hydroxy-7-cis-tetradecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15556}}
{{#set: consumed by=RXN-17794}}
+
{{#set: pathway associated=PWY-7511}}
{{#set: produced by=RXN-17793}}
+

Revision as of 10:55, 18 January 2018

Gene CHC_T00009358001

  • left end position:
    • 99280
  • transcription direction:
    • POSITIVE
  • right end position:
    • 100220
  • centisome position:
    • 69.06099
  • Synonym(s):

Reactions associated

  • RXN-15556
    • original_genome
      • automated-name-match

Pathways associated

External links