Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006957001_1 == * Synonym(s): == Reactions associated == * TRANS-RXN1HP7-13 ** pantograph-galdieria.sulphuraria == Pathways associ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == * smiles: ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == |
+ | * smiles: | ||
+ | ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J | ||
+ | * common name: | ||
+ | ** MoO2-molybdopterin cofactor | ||
+ | * molecular weight: | ||
+ | ** 519.251 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** MoCo (dioxyo) | ||
+ | ** molybdenum cofactor (dioxyo) | ||
+ | ** MoO2(OH)Dtpp-mP | ||
+ | ** {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate | ||
+ | ** MoO2-Mo-MPT | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8348]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680283 70680283] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71302 71302] | ||
+ | {{#set: smiles=C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))}} | ||
+ | {{#set: inchi key=InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J}} | ||
+ | {{#set: common name=MoO2-molybdopterin cofactor}} | ||
+ | {{#set: molecular weight=519.251 }} | ||
+ | {{#set: common name=MoCo (dioxyo)|molybdenum cofactor (dioxyo)|MoO2(OH)Dtpp-mP|{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate|MoO2-Mo-MPT}} | ||
+ | {{#set: produced by=RXN-8348}} |
Revision as of 10:57, 18 January 2018
Contents
Metabolite CPD-8123
- smiles:
- C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))
- inchi key:
- InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J
- common name:
- MoO2-molybdopterin cofactor
- molecular weight:
- 519.251
- Synonym(s):
- MoCo (dioxyo)
- molybdenum cofactor (dioxyo)
- MoO2(OH)Dtpp-mP
- {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate
- MoO2-Mo-MPT
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))" cannot be used as a page name in this wiki.
"{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate" cannot be used as a page name in this wiki.