Difference between revisions of "CPD-15692"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * smiles: ** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...")
 
(Created page with "Category:Gene == Gene CHC_T00002427001_1 == * Synonym(s): == Reactions associated == * DUTP-PYROP-RXN ** pantograph-galdieria.sulphuraria == Pathways associat...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] ==
+
== Gene CHC_T00002427001_1 ==
* smiles:
+
** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
+
* common name:
+
** 3-trans-decenoyl-CoA
+
* molecular weight:
+
** 915.738   
+
 
* Synonym(s):
 
* Synonym(s):
** 3E-decenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[DUTP-PYROP-RXN]]
* [[RXN-14803]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7206]]
 +
* [[PWY-7184]]
 +
* [[PWY-7187]]
 +
* [[PWY-6545]]
 +
* [[PWY0-166]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=DUTP-PYROP-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657610 90657610]
+
{{#set: pathway associated=PWY-7206|PWY-7184|PWY-7187|PWY-6545|PWY0-166}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84793 84793]
+
{{#set: smiles=CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J}}
+
{{#set: common name=3-trans-decenoyl-CoA}}
+
{{#set: molecular weight=915.738    }}
+
{{#set: common name=3E-decenoyl-CoA}}
+
{{#set: produced by=RXN-14803}}
+

Revision as of 10:57, 18 January 2018

Gene CHC_T00002427001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links