Difference between revisions of "CHC T00008996001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009130001 == * left end position: ** 586597 * transcription direction: ** POSITIVE * right end position: ** 588237 * centisome position: ** 89...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == * smiles: ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00009130001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] ==
−
* left end position:
+
* smiles:
−
** 586597
+
** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J
−
* right end position:
+
* common name:
−
** 588237
+
** 3-oxo-(5Z)-tetradecenoyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 89.78791    
+
** 985.829    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-5-cis-tetradecenoyl-CoA
 +
** 3-oxo-14:1-Δ5-CoA
 +
** 3-keto-5-cis-tetradecenoyl-CoA
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-13740]]
+
* [[RXN-14394]]
−
** original_genome
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-13741]]
+
−
** original_genome
+
−
***automated-name-match
+
−
* [[RXN-17229]]
+
−
** original_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=586597}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659295 90659295]
−
{{#set: right end position=588237}}
+
* CHEBI:
−
{{#set: centisome position=89.78791   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87707 87707]
−
{{#set: reaction associated=RXN-13740|RXN-13741|RXN-17229}}
+
{{#set: smiles=CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J}}
 +
{{#set: common name=3-oxo-(5Z)-tetradecenoyl-CoA}}
 +
{{#set: molecular weight=985.829   }}
 +
{{#set: common name=3-oxo-5-cis-tetradecenoyl-CoA|3-oxo-14:1-Δ5-CoA|3-keto-5-cis-tetradecenoyl-CoA}}
 +
{{#set: consumed by=RXN-14394}}

Revision as of 10:57, 18 January 2018

Metabolite CPD-15244

  • smiles:
    • CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J
  • common name:
    • 3-oxo-(5Z)-tetradecenoyl-CoA
  • molecular weight:
    • 985.829
  • Synonym(s):
    • 3-oxo-5-cis-tetradecenoyl-CoA
    • 3-oxo-14:1-Δ5-CoA
    • 3-keto-5-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008996001_1&oldid=5647"