Difference between revisions of "CHC T00009101001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Gene == Gene CHC_T00003815001_1 == * Synonym(s): == Reactions associated == * 3.1.26.4-RXN ** pantograph-galdieria.sulphuraria == Pathways associated...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00003815001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.1.26.4-RXN]] |
− | + | ** [[pantograph]]-[[galdieria.sulphuraria]] | |
− | + | == Pathways associated == | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.1.26.4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 11:57, 18 January 2018
Gene CHC_T00003815001_1
- Synonym(s):