Difference between revisions of "CHC T00008733001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
 
(Created page with "Category:Gene == Gene CHC_T00001817001_1 == * Synonym(s): == Reactions associated == * RXN-14971 ** pantograph-galdieria.sulphuraria * RXN-15378 ** pant...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+
== Gene CHC_T00001817001_1 ==
−
* smiles:
+
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
+
−
* common name:
+
−
** 1D-myo-inositol 5-monophosphate
+
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 5-monophosphate
 
−
** Ins(5)P1
 
−
** 1D-myo-inositol 5-phosphate
 
−
** Ins(5)P
 
−
** Ins5P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10953]]
+
* [[RXN-14971]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[galdieria.sulphuraria]]
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-15378]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-561]]
 +
* [[PWY-4302]]
 +
* [[PWY-3781]]
 +
* [[PWY0-1353]]
 +
* [[PWY-7279]]
 +
* [[P105-PWY]]
 +
* [[PWY-6969]]
 +
* [[PWY-6728]]
 +
* [[PWY0-1329]]
 +
* [[PWY-7254]]
 +
* [[TCA]]
 +
* [[PWY66-398]]
 +
* [[PWY-5690]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: reaction associated=RXN-14971|RXN-15378|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
+
{{#set: pathway associated=PWY-561|PWY-4302|PWY-3781|PWY0-1353|PWY-7279|P105-PWY|PWY-6969|PWY-6728|PWY0-1329|PWY-7254|TCA|PWY66-398|PWY-5690}}
−
{{#set: common name=1D-myo-inositol 5-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+
−
{{#set: consumed by=RXN-10953}}
+

Revision as of 11:58, 18 January 2018

Gene CHC_T00001817001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008733001_1&oldid=5694"