Difference between revisions of "ADP-D-Ribosyl-Acceptors"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * inchi key:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N |
* common name: | * common name: | ||
− | ** | + | ** β-maltose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** α-D-glucopyranose-(1→4)-β-D-glucopyranose |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15909]] | ||
+ | * [[RXN-1827]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01971 C01971] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18147 18147] |
− | * | + | * METABOLIGHTS : MTBLC18147 |
− | {{#set: smiles=C( | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6255 6255] |
− | {{#set: common name= | + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N}} |
− | {{#set: common name= | + | {{#set: common name=β-maltose}} |
− | {{#set: | + | {{#set: molecular weight=342.299 }} |
+ | {{#set: common name=α-D-glucopyranose-(1→4)-β-D-glucopyranose}} | ||
+ | {{#set: produced by=RXN-15909|RXN-1827}} |
Revision as of 10:58, 18 January 2018
Contents
Metabolite CPD-15717
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O
- inchi key:
- InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N
- common name:
- β-maltose
- molecular weight:
- 342.299
- Synonym(s):
- α-D-glucopyranose-(1→4)-β-D-glucopyranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links