Difference between revisions of "GLX-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == * smiles: ** C1(C=C(Cl)C(=CC=1[N+]([O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12540 RXN-12540] == * direction: ** LEFT-TO-RIGHT * common name: ** Fenton reaction * Synonym(s...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12540 RXN-12540] ==
−
* smiles:
+
* direction:
−
** C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 1-chloro-2,4-dinitrobenzene
+
** Fenton reaction
−
* molecular weight:
+
−
** 202.554   
+
 
* Synonym(s):
 
* Synonym(s):
−
** CDNB
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[FE+2]][c] '''=>''' 1 [[FE+3]][c] '''+''' 1 [[CPD-12377]][c] '''+''' 1 [[OH]][c]
−
* [[GST-RXN]]
+
* With common name(s):
 +
** 1 hydrogen peroxide[c] '''+''' 1 Fe2+[c] '''=>''' 1 Fe3+[c] '''+''' 1 hydroxyl radical[c] '''+''' 1 OH-[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[DETOX1-PWY-1]], reactive oxygen species degradation: [http://metacyc.org/META/NEW-IMAGE?object=DETOX1-PWY-1 DETOX1-PWY-1]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6854]], ethylene biosynthesis III (microbes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854]
 +
** '''5''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[original_genome]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6 6]
+
{{#set: common name=Fenton reaction}}
−
* CHEMSPIDER:
+
{{#set: in pathway=DETOX1-PWY-1|PWY-6854}}
−
** [http://www.chemspider.com/Chemical-Structure.13868426.html 13868426]
+
{{#set: reconstruction category=annotation}}
−
* NCI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6292 6292]
+
{{#set: reconstruction source=original_genome}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34718 34718]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C14397 C14397]
+
−
{{#set: smiles=C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N}}
+
−
{{#set: common name=1-chloro-2,4-dinitrobenzene}}
+
−
{{#set: molecular weight=202.554    }}
+
−
{{#set: common name=CDNB}}
+
−
{{#set: consumed or produced by=GST-RXN}}
+

Revision as of 10:59, 18 January 2018

Reaction RXN-12540

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Fenton reaction
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hydrogen peroxide[c] + 1 Fe2+[c] => 1 Fe3+[c] + 1 hydroxyl radical[c] + 1 OH-[c]

Genes associated with this reaction

Pathways

  • DETOX1-PWY-1, reactive oxygen species degradation: DETOX1-PWY-1
    • 5 reactions found over 6 reactions in the full pathway
  • PWY-6854, ethylene biosynthesis III (microbes): PWY-6854
    • 5 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=GLX-tRNAs&oldid=5833"