Difference between revisions of "CPD0-2500"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18350 CPD-18350] == * smiles: ** CCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=O)[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N |
* common name: | * common name: | ||
| − | ** | + | ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 697.095 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14177]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05814 C05814] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28636 28636] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280836 5280836] |
| − | {{#set: smiles= | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N}} |
| − | {{#set: common name= | + | {{#set: common name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=697.095 }} |
| − | + | {{#set: produced by=RXN-14177}} | |
| − | {{#set: produced by=RXN- | + | |
Revision as of 11:00, 18 January 2018
Contents
Metabolite CPD-15153
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)
- inchi key:
- InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N
- common name:
- 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
- molecular weight:
- 697.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
