Difference between revisions of "TRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate-5-semialdehyde LysW-L-glutamate-5-semialdehyde] == * common name: ** an [L-2-a...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LysW-L-glutamate-5-semialdehyde LysW-L-glutamate-5-semialdehyde] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** L- | + | ** an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a [LysW protein]-L-glutamate 5-semialdehyde |
| − | + | ** an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde | |
| − | + | ||
| − | + | ||
| − | ** L- | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15006]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-15007]] |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde}} | |
| − | + | {{#set: common name=a [LysW protein]-L-glutamate 5-semialdehyde|an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde}} | |
| − | + | {{#set: produced by=RXN-15006}} | |
| − | + | {{#set: consumed or produced by=RXN-15007}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: consumed or produced by= | + | |
Revision as of 11:01, 18 January 2018
Contents
Metabolite LysW-L-glutamate-5-semialdehyde
- common name:
- an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde
- Synonym(s):
- a [LysW protein]-L-glutamate 5-semialdehyde
- an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [L-2-aminoadipate carrier protein]-L-glutamate 5-semialdehyde" cannot be used as a page name in this wiki.
- "a [LysW protein]-L-glutamate 5-semialdehyde" cannot be used as a page name in this wiki.
- "an [α-aminoadipate carrier protein]-L-glutamate 5-semialdehyde" cannot be used as a page name in this wiki.
