Difference between revisions of "PWY-5665"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-678 CPD-678] == * smiles: ** [SeH2] * inchi key: ** InChIKey=SPVXKVOXSXTJOY-UHFFFAOYSA-N *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-678 CPD-678] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [SeH2] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SPVXKVOXSXTJOY-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** hydrogen selenide |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 80.976 |
* Synonym(s): | * Synonym(s): | ||
| + | ** dihydridoselenium | ||
| + | ** H2Se | ||
| + | ** selane | ||
| + | ** dihydrogen selenide | ||
| + | ** [SeH2] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12726]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CAS : 7783-07-5 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=533 533] |
| − | * HMDB : | + | * HMDB : HMDB11110 |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01528 C01528] |
| − | {{#set: common name= | + | * CHEMSPIDER: |
| − | {{#set: molecular weight= | + | ** [http://www.chemspider.com/Chemical-Structure.4885617.html 4885617] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16503 16503] | ||
| + | * BIGG : seln | ||
| + | {{#set: smiles=[SeH2]}} | ||
| + | {{#set: inchi key=InChIKey=SPVXKVOXSXTJOY-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=hydrogen selenide}} | ||
| + | {{#set: molecular weight=80.976 }} | ||
| + | {{#set: common name=dihydridoselenium|H2Se|selane|dihydrogen selenide|[SeH2]}} | ||
| + | {{#set: consumed by=RXN-12726}} | ||
Revision as of 11:01, 18 January 2018
Contents
Metabolite CPD-678
- smiles:
- [SeH2]
- inchi key:
- InChIKey=SPVXKVOXSXTJOY-UHFFFAOYSA-N
- common name:
- hydrogen selenide
- molecular weight:
- 80.976
- Synonym(s):
- dihydridoselenium
- H2Se
- selane
- dihydrogen selenide
- [SeH2]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7783-07-5
- PUBCHEM:
- HMDB : HMDB11110
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : seln
