Difference between revisions of "CHC T00001053001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** superpathway of L-aspartate and L-asparagine biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Interconversion of L-aspartate and L-asparagine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''4''' reaction(s) found |
− | * [[ | + | ** [[ASPARAGHYD-RXN]] |
− | * [[ | + | ** [[ASPARTATESYN-PWY]] |
− | == Reaction(s) | + | ** [[ASPARAGINESYN-PWY]] |
− | + | ** [[GLUTDEG-PWY]] | |
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ASPASN-PWY ASPASN-PWY] | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | ** [http:// | + | {{#set: common name=superpathway of L-aspartate and L-asparagine biosynthesis}} |
− | + | {{#set: common name=Interconversion of L-aspartate and L-asparagine}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 11:01, 18 January 2018
Pathway ASPASN-PWY
- taxonomic range:
- common name:
- superpathway of L-aspartate and L-asparagine biosynthesis
- Synonym(s):
- Interconversion of L-aspartate and L-asparagine
Reaction(s) found
- 4 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
External links
- ECOCYC: