Difference between revisions of "CHC T00004285001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6382 RXN-6382] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6382 RXN-6382] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1]
+
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
 +
* common name:
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
 +
* molecular weight:
 +
** 266.253   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15680]]
−
** 1 [[CPD-6082]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[B-ALANINE]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 2 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3-aminopropanal[c] '''+''' 1 H2O[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 β-alanine[c] '''+''' 1 NAD(P)H[c] '''+''' 2 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008341001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00008575001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-3981]], β-alanine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3981 PWY-3981]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-5760]], β-alanine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5760 PWY-5760]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.2.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
−
{{#set: gene associated=CHC_T00008341001_1|CHC_T00008575001_1}}
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
−
{{#set: in pathway=PWY-3981|PWY-5760}}
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=266.253    }}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: consumed by=RXN-15680}}

Revision as of 11:02, 18 January 2018

Metabolite CPD-17045

  • smiles:
    • C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
  • inchi key:
    • InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 266.253
  • Synonym(s):
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00004285001_1&oldid=6041"