Difference between revisions of "CPD-19170"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** diphthamide biosynthesis (archaea) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | * '''2''' reaction(s) found |
| − | == Reaction(s) | + | ** [[RXN-14326]] |
| − | + | ** [[DIPHTINE--AMMONIA-LIGASE-RXN]] | |
| − | * [ | + | == Reaction(s) not found == |
| + | * '''1''' reaction(s) not found | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11371 RXN-11371] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: common name=diphthamide biosynthesis (archaea)}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: reaction not found=1}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 12:02, 18 January 2018
Pathway PWY-6482
- taxonomic range:
- common name:
- diphthamide biosynthesis (archaea)
- Synonym(s):
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
