Difference between revisions of "PWY-5122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17365 CPD-17365] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J |
* common name: | * common name: | ||
| − | ** | + | ** (4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1075.997 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17116]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193701 72193701] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76368 76368] |
| − | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: molecular weight=1075.997 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa}} |
| − | {{#set: common name= | + | {{#set: produced by=RXN-17116}} |
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 12:02, 18 January 2018
Contents
Metabolite CPD-17365
- smiles:
- CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=QKBTYZDPVNTERQ-UWVCYPHHSA-J
- common name:
- (4Z,7Z,10Z,13Z,16Z)-docosapentaenoyl-CoA
- molecular weight:
- 1075.997
- Synonym(s):
- (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyl-Coa
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
