Difference between revisions of "RXN-11482"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008740001 == * left end position: ** 214600 * transcription direction: ** POSITIVE * right end position: ** 217764 * centisome position: ** 18...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N |
| − | * | + | * common name: |
| − | ** | + | ** demethylmenaquinol-8 |
| − | * | + | * molecular weight: |
| − | ** | + | ** 705.118 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-demethylmenaquinol-8 | ||
| + | ** DMKH2-8 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479277 45479277] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61873 61873] |
| − | {{#set: | + | * BIGG : 2dmmql8 |
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))}} | ||
| + | {{#set: inchi key=InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N}} | ||
| + | {{#set: common name=demethylmenaquinol-8}} | ||
| + | {{#set: molecular weight=705.118 }} | ||
| + | {{#set: common name=2-demethylmenaquinol-8|DMKH2-8}} | ||
| + | {{#set: consumed by=ADOMET-DMK-METHYLTRANSFER-RXN}} | ||
Revision as of 12:03, 18 January 2018
Contents
Metabolite CPD-12115
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2))
- inchi key:
- InChIKey=FGYPGICSXJEKCG-AENDIINCSA-N
- common name:
- demethylmenaquinol-8
- molecular weight:
- 705.118
- Synonym(s):
- 2-demethylmenaquinol-8
- DMKH2-8
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
