Difference between revisions of "CHC T00003649001 1"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4LZ-257 PWY4LZ-257] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 T...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=HPJVTYODWHYFMV-ZNWIKROFSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** demethylmenaquinol-13 |
+ | * molecular weight: | ||
+ | ** 1045.709 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** DMKH2-13 |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-9366]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479647 45479647] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84553 84553] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C)C}} |
+ | {{#set: inchi key=InChIKey=HPJVTYODWHYFMV-ZNWIKROFSA-N}} | ||
+ | {{#set: common name=demethylmenaquinol-13}} | ||
+ | {{#set: molecular weight=1045.709 }} | ||
+ | {{#set: common name=DMKH2-13}} | ||
+ | {{#set: consumed by=RXN-9366}} |
Revision as of 11:03, 18 January 2018
Contents
Metabolite CPD-12122
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C)C)C)C
- inchi key:
- InChIKey=HPJVTYODWHYFMV-ZNWIKROFSA-N
- common name:
- demethylmenaquinol-13
- molecular weight:
- 1045.709
- Synonym(s):
- DMKH2-13
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links